C12H15N5OS2 — CID 24522843
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 24522843) has the molecular formula C12H15N5OS2 and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 24522843 |
| Molecular Formula | C12H15N5OS2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-N-methyl-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | CN(Cc1cccs1)C(=O)CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C12H15N5OS2/c1-16(7-10-3-2-6-19-10)11(18)8-20-12-13-14-15-17(12)9-4-5-9/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | KCMXIYHAJQKEBA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |