C17H22BrN5OS — CID 24521893
N-[(2-bromophenyl)methyl]-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-methylacetamide (PubChem CID 24521893) has the molecular formula C17H22BrN5OS and a molecular weight of 424.37 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-methylacetamide.
| Compound Name | N-[(2-bromophenyl)methyl]-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 24521893 |
| Molecular Formula | C17H22BrN5OS |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-2-(1-cyclohexyltetrazol-5-yl)sulfanyl-N-methylacetamide |
| SMILES | CN(Cc1ccccc1Br)C(=O)CSc1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C17H22BrN5OS/c1-22(11-13-7-5-6-10-15(13)18)16(24)12-25-17-19-20-21-23(17)14-8-3-2-4-9-14/h5-7,10,14H,2-4,8-9,11-12H2,1H3 |
| InChIKey | WDCGOTHCACSPQB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |