C21H35N5OS — CID 3870642
N,N-dicyclohexyl-2-(1-cyclohexyltetrazol-5-yl)sulfanylacetamide (PubChem CID 3870642) has the molecular formula C21H35N5OS and a molecular weight of 405.61 g/mol. Its IUPAC name is N,N-dicyclohexyl-2-(1-cyclohexyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N,N-dicyclohexyl-2-(1-cyclohexyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 3870642 |
| Molecular Formula | C21H35N5OS |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | N,N-dicyclohexyl-2-(1-cyclohexyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1C1CCCCC1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H35N5OS/c27-20(16-28-21-22-23-24-26(21)19-14-8-3-9-15-19)25(17-10-4-1-5-11-17)18-12-6-2-7-13-18/h17-19H,1-16H2 |
| InChIKey | PSEGRZBADAQZLG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |