C10H17N5OS — CID 37044918
3-(1-cyclohexyltetrazol-5-yl)sulfanylpropanamide (PubChem CID 37044918) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is 3-(1-cyclohexyltetrazol-5-yl)sulfanylpropanamide.
| Compound Name | 3-(1-cyclohexyltetrazol-5-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 37044918 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 3-(1-cyclohexyltetrazol-5-yl)sulfanylpropanamide |
| SMILES | NC(=O)CCSc1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C10H17N5OS/c11-9(16)6-7-17-10-12-13-14-15(10)8-4-2-1-3-5-8/h8H,1-7H2,(H2,11,16) |
| InChIKey | TUOJZFKEQOWPHS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |