propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate

C11H18N4O2S — CID 47124350

IUPACpropan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate
SMILESCC(C)OC(=O)CSc1nnnn1C1CCCC1
InChIInChI=1S/C11H18N4O2S/c1-8(2)17-10(16)7-18-11-12-13-14-15(11)9-5-3-4-6-9/h8-9H,3-7H2,1-2H3
InChIKeyBIUKWMKVGABISQ-UHFFFAOYSA-N
MW270.36 g/mol
LogP1.83
Rot. Bonds5

About propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate

propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate (PubChem CID 47124350) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate.

Molecular Properties

Compound Namepropan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate
PubChem CID47124350
Molecular FormulaC11H18N4O2S
Molecular Weight270.36 g/mol
Exact Mass270.12
IUPAC Namepropan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate
SMILESCC(C)OC(=O)CSc1nnnn1C1CCCC1
InChIInChI=1S/C11H18N4O2S/c1-8(2)17-10(16)7-18-11-12-13-14-15(11)9-5-3-4-6-9/h8-9H,3-7H2,1-2H3
InChIKeyBIUKWMKVGABISQ-UHFFFAOYSA-N
XLogP1.83
TPSA69.90 Ų
H-Bond Donors
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.36
LogP ≤ 51.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 107

Analyze propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate?
The IUPAC name of propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate (CID 47124350) is propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate.
What is the SMILES notation for propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate?
The canonical SMILES for propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate is CC(C)OC(=O)CSc1nnnn1C1CCCC1.
What is the InChIKey of propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate?
The InChIKey is BIUKWMKVGABISQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O2S/c1-8(2)17-10(16)7-18-11-12-13-14-15(11)9-5-3-4-6-9/h8-9H,3-7H2,1-2H3.
What are the key properties of propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate?
propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate has a molecular weight of 270.36 g/mol, XLogP of 1.83, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(1-cyclopentyltetrazol-5-yl)sulfanylacetate is sourced from PubChem (CID 47124350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).