About 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol (PubChem CID 110897667) has the molecular formula C12H12F2N4OS
and a molecular weight of 298.32 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol |
| PubChem CID | 110897667 |
| Molecular Formula | C12H12F2N4OS |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol |
| SMILES | OC(CSc1nnnn1C1CC1)c1c(F)cccc1F |
| InChI | InChI=1S/C12H12F2N4OS/c13-8-2-1-3-9(14)11(8)10(19)6-20-12-15-16-17-18(12)7-4-5-7/h1-3,7,10,19H,4-6H2 |
| InChIKey | ROSBXYGIELBICZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol?
The IUPAC name of 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol (CID 110897667) is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol.
What is the SMILES notation for 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol?
The canonical SMILES for 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol is OC(CSc1nnnn1C1CC1)c1c(F)cccc1F.
What is the InChIKey of 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol?
The InChIKey is ROSBXYGIELBICZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2N4OS/c13-8-2-1-3-9(14)11(8)10(19)6-20-12-15-16-17-18(12)7-4-5-7/h1-3,7,10,19H,4-6H2.
What are the key properties of 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol?
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol has a molecular weight of 298.32 g/mol, XLogP of 2.11, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(2,6-difluorophenyl)ethanol is sourced from PubChem (CID 110897667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).