C12H11FN4OS — CID 43231278
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanone (PubChem CID 43231278) has the molecular formula C12H11FN4OS and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanone.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 43231278 |
| Molecular Formula | C12H11FN4OS |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanone |
| SMILES | O=C(CSc1nnnn1C1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H11FN4OS/c13-9-3-1-2-8(6-9)11(18)7-19-12-14-15-16-17(12)10-4-5-10/h1-3,6,10H,4-5,7H2 |
| InChIKey | ORYOOYWQVFVKNV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |