C12H14FN5S — CID 107524669
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanamine (PubChem CID 107524669) has the molecular formula C12H14FN5S and a molecular weight of 279.34 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanamine.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 107524669 |
| Molecular Formula | C12H14FN5S |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-(3-fluorophenyl)ethanamine |
| SMILES | NC(CSc1nnnn1C1CC1)c1cccc(F)c1 |
| InChI | InChI=1S/C12H14FN5S/c13-9-3-1-2-8(6-9)11(14)7-19-12-15-16-17-18(12)10-4-5-10/h1-3,6,10-11H,4-5,7,14H2 |
| InChIKey | JTEWQSDCZMUDRL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |