C11H12FN5S — CID 43382263
2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluoroaniline (PubChem CID 43382263) has the molecular formula C11H12FN5S and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluoroaniline.
| Compound Name | 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluoroaniline |
|---|---|
| PubChem CID | 43382263 |
| Molecular Formula | C11H12FN5S |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C11H12FN5S/c12-8-1-4-10(13)7(5-8)6-18-11-14-15-16-17(11)9-2-3-9/h1,4-5,9H,2-3,6,13H2 |
| InChIKey | RRYYJMNTXWNBKF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|