C10H12N6S — CID 62468379
3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine (PubChem CID 62468379) has the molecular formula C10H12N6S and a molecular weight of 248.31 g/mol. Its IUPAC name is 3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine.
| Compound Name | 3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62468379 |
| Molecular Formula | C10H12N6S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 3-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
| SMILES | Nc1ncccc1CSc1nnnn1C1CC1 |
| InChI | InChI=1S/C10H12N6S/c11-9-7(2-1-5-12-9)6-17-10-13-14-15-16(10)8-3-4-8/h1-2,5,8H,3-4,6H2,(H2,11,12) |
| InChIKey | LEWGSZYQNYQMSB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |