C10H11ClN6S — CID 62886003
5-chloro-6-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine (PubChem CID 62886003) has the molecular formula C10H11ClN6S and a molecular weight of 282.76 g/mol. Its IUPAC name is 5-chloro-6-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine.
| Compound Name | 5-chloro-6-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 62886003 |
| Molecular Formula | C10H11ClN6S |
| Molecular Weight | 282.76 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-chloro-6-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]pyridin-2-amine |
| SMILES | Nc1ccc(Cl)c(CSc2nnnn2C2CC2)n1 |
| InChI | InChI=1S/C10H11ClN6S/c11-7-3-4-9(12)13-8(7)5-18-10-14-15-16-17(10)6-1-2-6/h3-4,6H,1-2,5H2,(H2,12,13) |
| InChIKey | QRCGANFSJPTCFF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.76 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |