C12H12N6OS — CID 79998858
2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-1,3-benzoxazol-6-amine (PubChem CID 79998858) has the molecular formula C12H12N6OS and a molecular weight of 288.34 g/mol. Its IUPAC name is 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-1,3-benzoxazol-6-amine.
| Compound Name | 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 79998858 |
| Molecular Formula | C12H12N6OS |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 2-[(1-cyclopropyltetrazol-5-yl)sulfanylmethyl]-1,3-benzoxazol-6-amine |
| SMILES | Nc1ccc2nc(CSc3nnnn3C3CC3)oc2c1 |
| InChI | InChI=1S/C12H12N6OS/c13-7-1-4-9-10(5-7)19-11(14-9)6-20-12-15-16-17-18(12)8-2-3-8/h1,4-5,8H,2-3,6,13H2 |
| InChIKey | FYVKNDHMDKJERQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|