C14H19N5OS — CID 43247240
3-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-4-methoxyaniline (PubChem CID 43247240) has the molecular formula C14H19N5OS and a molecular weight of 305.41 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-4-methoxyaniline.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 43247240 |
| Molecular Formula | C14H19N5OS |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]-4-methoxyaniline |
| SMILES | COc1ccc(N)cc1CSc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C14H19N5OS/c1-20-13-7-6-11(15)8-10(13)9-21-14-16-17-18-19(14)12-4-2-3-5-12/h6-8,12H,2-5,9,15H2,1H3 |
| InChIKey | LXXYEKULPVRFPX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|