C16H22N4O2S — CID 647011
1-cyclohexyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]tetrazole (PubChem CID 647011) has the molecular formula C16H22N4O2S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-cyclohexyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]tetrazole.
| Compound Name | 1-cyclohexyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 647011 |
| Molecular Formula | C16H22N4O2S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-cyclohexyl-5-[2-(4-methoxyphenoxy)ethylsulfanyl]tetrazole |
| SMILES | COc1ccc(OCCSc2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C16H22N4O2S/c1-21-14-7-9-15(10-8-14)22-11-12-23-16-17-18-19-20(16)13-5-3-2-4-6-13/h7-10,13H,2-6,11-12H2,1H3 |
| InChIKey | WMKPQTTUSLAOMX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|