C19H25N5O2S — CID 39687325
2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]ethanone (PubChem CID 39687325) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]ethanone.
| Compound Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]ethanone |
|---|---|
| PubChem CID | 39687325 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-(1-cyclopropyltetrazol-5-yl)sulfanyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]ethanone |
| SMILES | COc1ccc([C@@H]2CCCCCN2C(=O)CSc2nnnn2C2CC2)cc1 |
| InChI | InChI=1S/C19H25N5O2S/c1-26-16-10-6-14(7-11-16)17-5-3-2-4-12-23(17)18(25)13-27-19-20-21-22-24(19)15-8-9-15/h6-7,10-11,15,17H,2-5,8-9,12-13H2,1H3/t17-/m0/s1 |
| InChIKey | KRZBTRJFIYXFJR-KRWDZBQOSA-N |
| XLogP | 3.25 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |