C18H26N2O4 — CID 94160238
methyl N-[2-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-N-methylcarbamate (PubChem CID 94160238) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl N-[2-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-N-methylcarbamate.
| Compound Name | methyl N-[2-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 94160238 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | methyl N-[2-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]-2-oxoethyl]-N-methylcarbamate |
| SMILES | COC(=O)N(C)CC(=O)N1CCCCC[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-19(18(22)24-3)13-17(21)20-12-6-4-5-7-16(20)14-8-10-15(23-2)11-9-14/h8-11,16H,4-7,12-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | NGIOJGPWMLGATM-INIZCTEOSA-N |
| XLogP | 2.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |