C18H26N2O2 — CID 94051830
(2R)-N-(cyclopropylmethyl)-2-(4-methoxyphenyl)azepane-1-carboxamide (PubChem CID 94051830) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-N-(cyclopropylmethyl)-2-(4-methoxyphenyl)azepane-1-carboxamide.
| Compound Name | (2R)-N-(cyclopropylmethyl)-2-(4-methoxyphenyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 94051830 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R)-N-(cyclopropylmethyl)-2-(4-methoxyphenyl)azepane-1-carboxamide |
| SMILES | COc1ccc([C@H]2CCCCCN2C(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C18H26N2O2/c1-22-16-10-8-15(9-11-16)17-5-3-2-4-12-20(17)18(21)19-13-14-6-7-14/h8-11,14,17H,2-7,12-13H2,1H3,(H,19,21)/t17-/m1/s1 |
| InChIKey | QXPYGGYUUMZNAT-QGZVFWFLSA-N |
| XLogP | 3.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |