C21H31NO2 — CID 95575791
3-cyclopentyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]propan-1-one (PubChem CID 95575791) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 3-cyclopentyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]propan-1-one |
|---|---|
| PubChem CID | 95575791 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 3-cyclopentyl-1-[(2S)-2-(4-methoxyphenyl)azepan-1-yl]propan-1-one |
| SMILES | COc1ccc([C@@H]2CCCCCN2C(=O)CCC2CCCC2)cc1 |
| InChI | InChI=1S/C21H31NO2/c1-24-19-13-11-18(12-14-19)20-9-3-2-6-16-22(20)21(23)15-10-17-7-4-5-8-17/h11-14,17,20H,2-10,15-16H2,1H3/t20-/m0/s1 |
| InChIKey | RJUWRUSBJOCMMS-FQEVSTJZSA-N |
| XLogP | 5.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |