C24H34N2O3 — CID 92549946
1-[(3S,3aR,7aR)-1-acetyl-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-3-cyclopentylpropan-1-one (PubChem CID 92549946) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[(3S,3aR,7aR)-1-acetyl-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-3-cyclopentylpropan-1-one.
| Compound Name | 1-[(3S,3aR,7aR)-1-acetyl-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-3-cyclopentylpropan-1-one |
|---|---|
| PubChem CID | 92549946 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | 1-[(3S,3aR,7aR)-1-acetyl-3-(4-methoxyphenyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridin-4-yl]-3-cyclopentylpropan-1-one |
| SMILES | COc1ccc([C@H]2CN(C(C)=O)[C@@H]3CCCN(C(=O)CCC4CCCC4)[C@H]23)cc1 |
| InChI | InChI=1S/C24H34N2O3/c1-17(27)26-16-21(19-10-12-20(29-2)13-11-19)24-22(26)8-5-15-25(24)23(28)14-9-18-6-3-4-7-18/h10-13,18,21-22,24H,3-9,14-16H2,1-2H3/t21-,22-,24-/m1/s1 |
| InChIKey | CAWZQIQCXVRLJV-CQOQZXRMSA-N |
| XLogP | 3.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |