C25H32N2O3 — CID 110090483
tert-butyl (3R,3aS,7aS)-3-(4-methoxyphenyl)-1-phenyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate (PubChem CID 110090483) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is tert-butyl (3R,3aS,7aS)-3-(4-methoxyphenyl)-1-phenyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate.
| Compound Name | tert-butyl (3R,3aS,7aS)-3-(4-methoxyphenyl)-1-phenyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 110090483 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | tert-butyl (3R,3aS,7aS)-3-(4-methoxyphenyl)-1-phenyl-3,3a,5,6,7,7a-hexahydro-2H-pyrrolo[3,2-b]pyridine-4-carboxylate |
| SMILES | COc1ccc([C@@H]2CN(c3ccccc3)[C@H]3CCCN(C(=O)OC(C)(C)C)[C@@H]23)cc1 |
| InChI | InChI=1S/C25H32N2O3/c1-25(2,3)30-24(28)26-16-8-11-22-23(26)21(18-12-14-20(29-4)15-13-18)17-27(22)19-9-6-5-7-10-19/h5-7,9-10,12-15,21-23H,8,11,16-17H2,1-4H3/t21-,22-,23-/m0/s1 |
| InChIKey | HJYBYWYLHKVMOK-VABKMULXSA-N |
| XLogP | 5.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |