C16H24N2O3 — CID 69191573
tert-butyl 2-(4-methoxyanilino)pyrrolidine-1-carboxylate (PubChem CID 69191573) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is tert-butyl 2-(4-methoxyanilino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(4-methoxyanilino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69191573 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | tert-butyl 2-(4-methoxyanilino)pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(NC2CCCN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24N2O3/c1-16(2,3)21-15(19)18-11-5-6-14(18)17-12-7-9-13(20-4)10-8-12/h7-10,14,17H,5-6,11H2,1-4H3 |
| InChIKey | XJOAUCAEJSUEKT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|