C10H20N2O2 — CID 68972263
tert-butyl (2S)-2-(methylamino)pyrrolidine-1-carboxylate (PubChem CID 68972263) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is tert-butyl (2S)-2-(methylamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(methylamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 68972263 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | tert-butyl (2S)-2-(methylamino)pyrrolidine-1-carboxylate |
| SMILES | CN[C@@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-7-5-6-8(12)11-4/h8,11H,5-7H2,1-4H3/t8-/m0/s1 |
| InChIKey | JTSBLYBEXPJERJ-QMMMGPOBSA-N |
| XLogP | 1.56 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |