C10H18N2O4 — CID 14471857
tert-butyl (2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carboxylate (PubChem CID 14471857) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is tert-butyl (2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14471857 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | tert-butyl (2S)-2-(hydroxycarbamoyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NO |
| InChI | InChI=1S/C10H18N2O4/c1-10(2,3)16-9(14)12-6-4-5-7(12)8(13)11-15/h7,15H,4-6H2,1-3H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | QRXFGAFSGGJJHI-ZETCQYMHSA-N |
| XLogP | 0.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|