C11H19CrN2O3- — CID 173484458
tert-butyl 2-(methanidylcarbamoyl)pyrrolidine-1-carboxylate;chromium (PubChem CID 173484458) has the molecular formula C11H19CrN2O3- and a molecular weight of 279.28 g/mol. Its IUPAC name is tert-butyl 2-(methanidylcarbamoyl)pyrrolidine-1-carboxylate;chromium.
| Compound Name | tert-butyl 2-(methanidylcarbamoyl)pyrrolidine-1-carboxylate;chromium |
|---|---|
| PubChem CID | 173484458 |
| Molecular Formula | C11H19CrN2O3- |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | tert-butyl 2-(methanidylcarbamoyl)pyrrolidine-1-carboxylate;chromium |
| SMILES | [CH2-]NC(=O)C1CCCN1C(=O)OC(C)(C)C.[Cr] |
| InChI | InChI=1S/C11H19N2O3.Cr/c1-11(2,3)16-10(15)13-7-5-6-8(13)9(14)12-4;/h8H,4-7H2,1-3H3,(H,12,14);/q-1; |
| InChIKey | DPOZIXLMPOPHBV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|