C13H23N3O4 — CID 131748452
tert-butyl (2S)-2-(acetamidocarbamoyl)piperidine-1-carboxylate (PubChem CID 131748452) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl (2S)-2-(acetamidocarbamoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(acetamidocarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131748452 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | tert-butyl (2S)-2-(acetamidocarbamoyl)piperidine-1-carboxylate |
| SMILES | CC(=O)NNC(=O)[C@@H]1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O4/c1-9(17)14-15-11(18)10-7-5-6-8-16(10)12(19)20-13(2,3)4/h10H,5-8H2,1-4H3,(H,14,17)(H,15,18)/t10-/m0/s1 |
| InChIKey | LFDGPTUSODHLEC-JTQLQIEISA-N |
| XLogP | 0.94 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|