C20H32N2O7 — CID 14237873
1-O-tert-butyl 2-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl] pyrrolidine-1,2-dicarboxylate (PubChem CID 14237873) has the molecular formula C20H32N2O7 and a molecular weight of 412.48 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl] pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl] pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 14237873 |
| Molecular Formula | C20H32N2O7 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | 1-O-tert-butyl 2-O-[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carbonyl] pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H32N2O7/c1-19(2,3)28-17(25)21-11-7-9-13(21)15(23)27-16(24)14-10-8-12-22(14)18(26)29-20(4,5)6/h13-14H,7-12H2,1-6H3 |
| InChIKey | JKAAHFHXTOGATB-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|