C11H18NO4Si — CID 155769942
CID 155769942 (PubChem CID 155769942) has the molecular formula C11H18NO4Si and a molecular weight of 256.35 g/mol.
| Compound Name | CID 155769942 |
|---|---|
| PubChem CID | 155769942 |
| Molecular Formula | C11H18NO4Si |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OC[Si] |
| InChI | InChI=1S/C11H18NO4Si/c1-11(2,3)16-10(14)12-6-4-5-8(12)9(13)15-7-17/h8H,4-7H2,1-3H3 |
| InChIKey | RPDRRCQFSAUONX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|