C13H22BrNO4 — CID 21099364
2-O-(3-bromopropyl) 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 21099364) has the molecular formula C13H22BrNO4 and a molecular weight of 336.23 g/mol. Its IUPAC name is 2-O-(3-bromopropyl) 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-(3-bromopropyl) 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 21099364 |
| Molecular Formula | C13H22BrNO4 |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-O-(3-bromopropyl) 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCCCBr |
| InChI | InChI=1S/C13H22BrNO4/c1-13(2,3)19-12(17)15-8-4-6-10(15)11(16)18-9-5-7-14/h10H,4-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | SXJPKPLOVAWYTE-JTQLQIEISA-N |
| XLogP | 2.71 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|