C14H24N2O7 — CID 59287822
1-O-tert-butyl 2-O-(4-nitrooxybutyl) pyrrolidine-1,2-dicarboxylate (PubChem CID 59287822) has the molecular formula C14H24N2O7 and a molecular weight of 332.35 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-(4-nitrooxybutyl) pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-(4-nitrooxybutyl) pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 59287822 |
| Molecular Formula | C14H24N2O7 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 1-O-tert-butyl 2-O-(4-nitrooxybutyl) pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C(=O)OCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C14H24N2O7/c1-14(2,3)23-13(18)15-8-6-7-11(15)12(17)21-9-4-5-10-22-16(19)20/h11H,4-10H2,1-3H3 |
| InChIKey | FJQBAEOJSBEFFM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|