C14H24BrNO2 — CID 101202508
tert-butyl 2-(5-bromopent-1-en-2-yl)pyrrolidine-1-carboxylate (PubChem CID 101202508) has the molecular formula C14H24BrNO2 and a molecular weight of 318.26 g/mol. Its IUPAC name is tert-butyl 2-(5-bromopent-1-en-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(5-bromopent-1-en-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101202508 |
| Molecular Formula | C14H24BrNO2 |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | tert-butyl 2-(5-bromopent-1-en-2-yl)pyrrolidine-1-carboxylate |
| SMILES | C=C(CCCBr)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24BrNO2/c1-11(7-5-9-15)12-8-6-10-16(12)13(17)18-14(2,3)4/h12H,1,5-10H2,2-4H3 |
| InChIKey | NWKKIZPUBXIGER-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|