C14H25NO2 — CID 102537800
tert-butyl 2-but-1-en-2-ylpiperidine-1-carboxylate (PubChem CID 102537800) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is tert-butyl 2-but-1-en-2-ylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-but-1-en-2-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102537800 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | tert-butyl 2-but-1-en-2-ylpiperidine-1-carboxylate |
| SMILES | C=C(CC)C1CCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO2/c1-6-11(2)12-9-7-8-10-15(12)13(16)17-14(3,4)5/h12H,2,6-10H2,1,3-5H3 |
| InChIKey | CVSQWRJIKZMXCV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|