C16H27NO4 — CID 73010431
1-O-tert-butyl 2-O-hex-1-en-2-yl pyrrolidine-1,2-dicarboxylate (PubChem CID 73010431) has the molecular formula C16H27NO4 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-hex-1-en-2-yl pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-hex-1-en-2-yl pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 73010431 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 1-O-tert-butyl 2-O-hex-1-en-2-yl pyrrolidine-1,2-dicarboxylate |
| SMILES | C=C(CCCC)OC(=O)C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H27NO4/c1-6-7-9-12(2)20-14(18)13-10-8-11-17(13)15(19)21-16(3,4)5/h13H,2,6-11H2,1,3-5H3 |
| InChIKey | RWMLVJCGNZUBOG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|