C16H33NO4 — CID 145080394
butane;ethane;1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (PubChem CID 145080394) has the molecular formula C16H33NO4 and a molecular weight of 303.44 g/mol. Its IUPAC name is butane;ethane;1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid.
| Compound Name | butane;ethane;1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 145080394 |
| Molecular Formula | C16H33NO4 |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.24 |
| IUPAC Name | butane;ethane;1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC1C(=O)O.CCCC |
| InChI | InChI=1S/C10H17NO4.C4H10.C2H6/c1-10(2,3)15-9(14)11-6-4-5-7(11)8(12)13;1-3-4-2;1-2/h7H,4-6H2,1-3H3,(H,12,13);3-4H2,1-2H3;1-2H3 |
| InChIKey | JERDWITZPNZXEI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |