C11H19NO4 — CID 86335614
1-O-tert-butyl 2-O-ethyl (2R)-azetidine-1,2-dicarboxylate (PubChem CID 86335614) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R)-azetidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R)-azetidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 86335614 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R)-azetidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19NO4/c1-5-15-9(13)8-6-7-12(8)10(14)16-11(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | IKEVFCBVUFBCBE-MRVPVSSYSA-N |
| XLogP | 1.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |