C15H22F3NO6 — CID 67586505
1-O-tert-butyl 2-O-ethyl (2R,4R)-4-(2,2,2-trifluoroacetyl)oxypiperidine-1,2-dicarboxylate (PubChem CID 67586505) has the molecular formula C15H22F3NO6 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,4R)-4-(2,2,2-trifluoroacetyl)oxypiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,4R)-4-(2,2,2-trifluoroacetyl)oxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67586505 |
| Molecular Formula | C15H22F3NO6 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,4R)-4-(2,2,2-trifluoroacetyl)oxypiperidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H](OC(=O)C(F)(F)F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22F3NO6/c1-5-23-11(20)10-8-9(24-12(21)15(16,17)18)6-7-19(10)13(22)25-14(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | SDBICJWTSKHFME-NXEZZACHSA-N |
| XLogP | 2.42 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|