C13H20F3NO7S — CID 176761753
1-O-tert-butyl 2-O-methyl (2R)-4-(trifluoromethylsulfonyloxy)piperidine-1,2-dicarboxylate (PubChem CID 176761753) has the molecular formula C13H20F3NO7S and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R)-4-(trifluoromethylsulfonyloxy)piperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R)-4-(trifluoromethylsulfonyloxy)piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 176761753 |
| Molecular Formula | C13H20F3NO7S |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R)-4-(trifluoromethylsulfonyloxy)piperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1CC(OS(=O)(=O)C(F)(F)F)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H20F3NO7S/c1-12(2,3)23-11(19)17-6-5-8(7-9(17)10(18)22-4)24-25(20,21)13(14,15)16/h8-9H,5-7H2,1-4H3/t8?,9-/m1/s1 |
| InChIKey | SLZBCWBLFKCSAZ-YGPZHTELSA-N |
| XLogP | 1.79 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|