C14H23NO5S — CID 11151273
1-O-tert-butyl 2-O-methyl (2R,4S)-4-acetylsulfanylpiperidine-1,2-dicarboxylate (PubChem CID 11151273) has the molecular formula C14H23NO5S and a molecular weight of 317.41 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,4S)-4-acetylsulfanylpiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-acetylsulfanylpiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11151273 |
| Molecular Formula | C14H23NO5S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,4S)-4-acetylsulfanylpiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H](SC(C)=O)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO5S/c1-9(16)21-10-6-7-15(11(8-10)12(17)19-5)13(18)20-14(2,3)4/h10-11H,6-8H2,1-5H3/t10-,11+/m0/s1 |
| InChIKey | YVEMNJHMDMHRGM-WDEREUQCSA-N |
| XLogP | 2.21 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|