C11H18INO4 — CID 11002744
1-O-tert-butyl 2-O-methyl (2S,4S)-4-iodopyrrolidine-1,2-dicarboxylate (PubChem CID 11002744) has the molecular formula C11H18INO4 and a molecular weight of 355.17 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4S)-4-iodopyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-iodopyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11002744 |
| Molecular Formula | C11H18INO4 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-iodopyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](I)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H18INO4/c1-11(2,3)17-10(15)13-6-7(12)5-8(13)9(14)16-4/h7-8H,5-6H2,1-4H3/t7-,8-/m0/s1 |
| InChIKey | VGFYULNTTQXRQU-YUMQZZPRSA-N |
| XLogP | 1.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|