C13H23NO4Y-2 — CID 59623801
1-O-tert-butyl 2-O-methyl (2S,4R)-4-methanidylpyrrolidine-1,2-dicarboxylate;carbanide;yttrium (PubChem CID 59623801) has the molecular formula C13H23NO4Y-2 and a molecular weight of 346.24 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methanidylpyrrolidine-1,2-dicarboxylate;carbanide;yttrium.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methanidylpyrrolidine-1,2-dicarboxylate;carbanide;yttrium |
|---|---|
| PubChem CID | 59623801 |
| Molecular Formula | C13H23NO4Y-2 |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-methanidylpyrrolidine-1,2-dicarboxylate;carbanide;yttrium |
| SMILES | [CH2-][C@@H]1C[C@@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1.[CH3-].[Y] |
| InChI | InChI=1S/C12H20NO4.CH3.Y/c1-8-6-9(10(14)16-5)13(7-8)11(15)17-12(2,3)4;;/h8-9H,1,6-7H2,2-5H3;1H3;/q2*-1;/t8-,9+;;/m1../s1 |
| InChIKey | LSRZZPDBSBEIJH-BPRGXCPLSA-N |
| XLogP | 2.07 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|