C14H23N5O4S — CID 67586796
1-O-tert-butyl 2-O-ethyl 4-(5-sulfanylidene-2H-tetrazol-1-yl)piperidine-1,2-dicarboxylate (PubChem CID 67586796) has the molecular formula C14H23N5O4S and a molecular weight of 357.44 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl 4-(5-sulfanylidene-2H-tetrazol-1-yl)piperidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl 4-(5-sulfanylidene-2H-tetrazol-1-yl)piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67586796 |
| Molecular Formula | C14H23N5O4S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl 4-(5-sulfanylidene-2H-tetrazol-1-yl)piperidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)C1CC(n2[nH]nnc2=S)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N5O4S/c1-5-22-11(20)10-8-9(19-12(24)15-16-17-19)6-7-18(10)13(21)23-14(2,3)4/h9-10H,5-8H2,1-4H3,(H,15,17,24) |
| InChIKey | OYIQPRDLVQCVST-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|