C15H23NO5 — CID 170903972
2-O-tert-butyl 6-O-ethyl (1S,5R)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate (PubChem CID 170903972) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-O-tert-butyl 6-O-ethyl (1S,5R)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate.
| Compound Name | 2-O-tert-butyl 6-O-ethyl (1S,5R)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 170903972 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-O-tert-butyl 6-O-ethyl (1S,5R)-7-oxo-2-azabicyclo[3.2.1]octane-2,6-dicarboxylate |
| SMILES | CCOC(=O)C1C(=O)[C@@H]2C[C@H]1CCN2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO5/c1-5-20-13(18)11-9-6-7-16(10(8-9)12(11)17)14(19)21-15(2,3)4/h9-11H,5-8H2,1-4H3/t9-,10+,11?/m1/s1 |
| InChIKey | CLJWEFNNEJTWCN-JKIOLJMWSA-N |
| XLogP | 1.76 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|