C19H31NO5 — CID 10594230
2-O-tert-butyl 1-O-ethyl (1R,4aR,6E,8aR)-6-(methoxymethylidene)-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-1,2-dicarboxylate (PubChem CID 10594230) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-ethyl (1R,4aR,6E,8aR)-6-(methoxymethylidene)-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-ethyl (1R,4aR,6E,8aR)-6-(methoxymethylidene)-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10594230 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-O-tert-butyl 1-O-ethyl (1R,4aR,6E,8aR)-6-(methoxymethylidene)-1,3,4,4a,5,7,8,8a-octahydroisoquinoline-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@@H]2CC/C(=C\OC)C[C@@H]2CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H31NO5/c1-6-24-17(21)16-15-8-7-13(12-23-5)11-14(15)9-10-20(16)18(22)25-19(2,3)4/h12,14-16H,6-11H2,1-5H3/b13-12+/t14-,15+,16+/m0/s1 |
| InChIKey | MUGYQQIDLNVDTG-JDCHRCQMSA-N |
| XLogP | 3.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|