C18H30N2O7 — CID 156904031
1-O,4-O-ditert-butyl 2-O-ethyl (2R,3R)-3-formylpiperazine-1,2,4-tricarboxylate (PubChem CID 156904031) has the molecular formula C18H30N2O7 and a molecular weight of 386.45 g/mol. Its IUPAC name is 1-O,4-O-ditert-butyl 2-O-ethyl (2R,3R)-3-formylpiperazine-1,2,4-tricarboxylate.
| Compound Name | 1-O,4-O-ditert-butyl 2-O-ethyl (2R,3R)-3-formylpiperazine-1,2,4-tricarboxylate |
|---|---|
| PubChem CID | 156904031 |
| Molecular Formula | C18H30N2O7 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-O,4-O-ditert-butyl 2-O-ethyl (2R,3R)-3-formylpiperazine-1,2,4-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H](C=O)N(C(=O)OC(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N2O7/c1-8-25-14(22)13-12(11-21)19(15(23)26-17(2,3)4)9-10-20(13)16(24)27-18(5,6)7/h11-13H,8-10H2,1-7H3/t12-,13+/m0/s1 |
| InChIKey | HOAZJQBBPPXPBL-QWHCGFSZSA-N |
| XLogP | 1.97 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|