C15H28N2O4 — CID 90070662
ditert-butyl (2S)-4-aminopiperidine-1,2-dicarboxylate (PubChem CID 90070662) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is ditert-butyl (2S)-4-aminopiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-4-aminopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 90070662 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | ditert-butyl (2S)-4-aminopiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CC(N)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O4/c1-14(2,3)20-12(18)11-9-10(16)7-8-17(11)13(19)21-15(4,5)6/h10-11H,7-9,16H2,1-6H3/t10?,11-/m0/s1 |
| InChIKey | FOXGHYMKQRUTCE-DTIOYNMSSA-N |
| XLogP | 2.05 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |