C21H41NO5Si — CID 101367108
ditert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate (PubChem CID 101367108) has the molecular formula C21H41NO5Si and a molecular weight of 415.65 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101367108 |
| Molecular Formula | C21H41NO5Si |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | ditert-butyl (2S,4S)-4-[tert-butyl(dimethyl)silyl]oxypiperidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41NO5Si/c1-19(2,3)25-17(23)16-14-15(27-28(10,11)21(7,8)9)12-13-22(16)18(24)26-20(4,5)6/h15-16H,12-14H2,1-11H3/t15-,16-/m0/s1 |
| InChIKey | SVPDIZQUJOOXPU-HOTGVXAUSA-N |
| XLogP | 5.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|