C18H35NO3Si — CID 85290251
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate (PubChem CID 85290251) has the molecular formula C18H35NO3Si and a molecular weight of 341.57 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 85290251 |
| Molecular Formula | C18H35NO3Si |
| Molecular Weight | 341.57 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-prop-1-en-2-ylpyrrolidine-1-carboxylate |
| SMILES | C=C(C)C1CC(O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H35NO3Si/c1-13(2)15-11-14(22-23(9,10)18(6,7)8)12-19(15)16(20)21-17(3,4)5/h14-15H,1,11-12H2,2-10H3 |
| InChIKey | KBEAADSWOPGFKU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|