C18H37NO5Si — CID 67885392
tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate (PubChem CID 67885392) has the molecular formula C18H37NO5Si and a molecular weight of 375.58 g/mol. Its IUPAC name is tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67885392 |
| Molecular Formula | C18H37NO5Si |
| Molecular Weight | 375.58 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | tert-butyl 4-[tert-butyl(dimethyl)silyl]oxy-2-[(1S)-1,3-dihydroxypropyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](C)(C)C(C)(C)C)CC1[C@@H](O)CCO |
| InChI | InChI=1S/C18H37NO5Si/c1-17(2,3)23-16(22)19-12-13(11-14(19)15(21)9-10-20)24-25(7,8)18(4,5)6/h13-15,20-21H,9-12H2,1-8H3/t13?,14?,15-/m0/s1 |
| InChIKey | ALHMVCMAWBJKAF-NRXISQOPSA-N |
| XLogP | 3.13 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.58 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|