C17H36N2O5Si — CID 160879696
azane;1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate (PubChem CID 160879696) has the molecular formula C17H36N2O5Si and a molecular weight of 376.57 g/mol. Its IUPAC name is azane;1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate.
| Compound Name | azane;1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 160879696 |
| Molecular Formula | C17H36N2O5Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | azane;1-O-tert-butyl 2-O-methyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxypyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1C(=O)OC(C)(C)C.N |
| InChI | InChI=1S/C17H33NO5Si.H3N/c1-16(2,3)22-15(20)18-11-12(10-13(18)14(19)21-7)23-24(8,9)17(4,5)6;/h12-13H,10-11H2,1-9H3;1H3/t12-,13+;/m1./s1 |
| InChIKey | ISIQPSLPDNSCJO-KZCZEQIWSA-N |
| XLogP | 3.72 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|