C13H23NO6 — CID 169081771
1-O-tert-butyl 2-O-methyl (2R,4R)-4-(methoxymethoxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 169081771) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2R,4R)-4-(methoxymethoxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-(methoxymethoxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 169081771 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-(methoxymethoxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | COCO[C@@H]1C[C@H](C(=O)OC)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23NO6/c1-13(2,3)20-12(16)14-7-9(19-8-17-4)6-10(14)11(15)18-5/h9-10H,6-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | XLGHJEFDLJJOFT-NXEZZACHSA-N |
| XLogP | 1.16 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|