C13H22BrNO5 — CID 58331119
1-O-tert-butyl 2-O-methyl (4S)-4-(2-bromoethoxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 58331119) has the molecular formula C13H22BrNO5 and a molecular weight of 352.23 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (4S)-4-(2-bromoethoxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (4S)-4-(2-bromoethoxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 58331119 |
| Molecular Formula | C13H22BrNO5 |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (4S)-4-(2-bromoethoxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)C1C[C@H](OCCBr)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22BrNO5/c1-13(2,3)20-12(17)15-8-9(19-6-5-14)7-10(15)11(16)18-4/h9-10H,5-8H2,1-4H3/t9-,10?/m0/s1 |
| InChIKey | LUHXWFJXPHDYLF-RGURZIINSA-N |
| XLogP | 1.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|